 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OC1CC(OC1CO)n1c2ncnc(N)c2nc1)(OCC1OC(N2C=CC(=NC2=O)N)CC1O) (=O)[O-] |
| InChI: | InChI=1/C19H25N8O9P/c20-13-1-2-26(19(30)25-13)14-3-9(29)12(35-14)6-33-37(31,32)36-10-4-15(34-11(10)5-28)27-8-24-16-17(21)22-7-23-18(16)27/h1-2,7-12,14-15,28-29H,3-6H2,(H,31,32)(H2,20,25,30)(H2,21,22,23)/p-1/t9-,10+,11+,12-,14-,15+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-0.892718 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 539.422 g/mol | logS: -2.65999 | SlogP: -2.6338 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0835703 | Sterimol/B1: 4.42056 | Sterimol/B2: 4.6064 | Sterimol/B3: 4.75107 | |||
| Sterimol/B4: 8.40728 | Sterimol/L: 17.0127 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 764.541 | Positive charged surface: 513.798 | Negative charged surface: 250.743 | Volume: 434.75 | |||
| Hydrophobic surface: 325.814 | Hydrophilic surface: 438.727 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 11 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
