 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC([NH+]2C=3NC(=O)NC(=O)C=3N=C2)C(O)C1O)(O)(O)=O |
| InChI: | InChI=1/C10H13N4O9P/c15-5-3(1-22-24(19,20)21)23-9(6(5)16)14-2-11-4-7(14)12-10(18)13-8(4)17/h2-3,5-6,9,15-16H,1H2,(H2,19,20,21)(H2,12,13,17,18)/p+1/t3-,5+,6-,9-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-35.7352 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 365.215 g/mol | logS: -0.36761 | SlogP: -5.5925 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.171003 | Sterimol/B1: 2.27015 | Sterimol/B2: 4.97077 | Sterimol/B3: 5.73404 | |||
| Sterimol/B4: 6.47979 | Sterimol/L: 13.0956 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 538.685 | Positive charged surface: 319.744 | Negative charged surface: 218.941 | Volume: 265.875 | |||
| Hydrophobic surface: 87.6425 | Hydrophilic surface: 451.0425 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 7 | Hydrogen bond acceptors: 10 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
