 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C([O-])C([NH2+]C(CCC(=O)[O-])C(=O)[O-])CCCNC(=[NH2+])N |
| InChI: | InChI=1/C11H20N4O6/c12-11(13)14-5-1-2-6(9(18)19)15-7(10(20)21)3-4-8(16)17/h6-7,15H,1-5H2,(H,16,17)(H,18,19)(H,20,21)(H4,12,13,14)/p-1/t6-,7-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-48.5834 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 303.295 g/mol | logS: -0.88534 | SlogP: -8.2395 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0731184 | Sterimol/B1: 3.04946 | Sterimol/B2: 4.38879 | Sterimol/B3: 5.13779 | |||
| Sterimol/B4: 5.62233 | Sterimol/L: 15.286 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 512.21 | Positive charged surface: 318.233 | Negative charged surface: 193.978 | Volume: 266.875 | |||
| Hydrophobic surface: 155.87 | Hydrophilic surface: 356.34 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 0 | Acid groups: 6 | Basic groups: 4 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
