 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(CCCNC(=[NH2+])N)C(=O)[O-])C([NH3+])CCCNC(=[NH2+])N |
| InChI: | InChI=1/C12H26N8O3/c13-7(3-1-5-18-11(14)15)9(21)20-8(10(22)23)4-2-6-19-12(16)17/h7-8H,1-6,13H2,(H,20,21)(H,22,23)(H4,14,15,18)(H4,16,17,19)/p+2/t7-,8+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-98.8859 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 332.409 g/mol | logS: -1.08575 | SlogP: -8.2812 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0438932 | Sterimol/B1: 2.73759 | Sterimol/B2: 3.46807 | Sterimol/B3: 5.17664 | |||
| Sterimol/B4: 8.28314 | Sterimol/L: 15.1645 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 644.532 | Positive charged surface: 505.512 | Negative charged surface: 139.02 | Volume: 320.125 | |||
| Hydrophobic surface: 174.937 | Hydrophilic surface: 469.595 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 7 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
