Type: Ionized
Formula: C6H8NO8P-2
SMILES: |
P(O)(O)(=O)CC(=O)NC(CC(=O)[O-])C(=O)[O-] |
InChI: |
InChI=1/C6H10NO8P/c8-4(2-16(13,14)15)7-3(6(11)12)1-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12)(H2,13,14,15)/p-2/t3-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 253.103 g/mol | logS: 0.51191 | SlogP: -5.5314 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0730308 | Sterimol/B1: 3.16131 | Sterimol/B2: 3.35608 | Sterimol/B3: 4.00012 |
Sterimol/B4: 4.82442 | Sterimol/L: 12.953 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 409.185 | Positive charged surface: 168.418 | Negative charged surface: 240.767 | Volume: 179.75 |
Hydrophobic surface: 86.8258 | Hydrophilic surface: 322.3592 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 4 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|