 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N(CC)CC)c1ccc(cc1)C(=O)NC(C(=O)[O-])C12CC3CC(C1)CC (C2)C3 |
| InChI: | InChI=1/C23H32N2O5S/c1-3-25(4-2)31(29,30)19-7-5-18(6-8-19)21(26)24-20(22(27)28)23-12-15-9-16(13-23)11-17(10-15)14-23/h5-8,15-17,20H,3-4,9-14H2,1-2H3,(H,24,26)(H,27,28)/p-1/t15-,16+,17-,20-,23-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=69.734 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 447.576 g/mol | logS: -6.073 | SlogP: 1.7818 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0861148 | Sterimol/B1: 2.53385 | Sterimol/B2: 4.21398 | Sterimol/B3: 5.33244 | |||
| Sterimol/B4: 6.55068 | Sterimol/L: 18.6814 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 689.093 | Positive charged surface: 438.945 | Negative charged surface: 250.148 | Volume: 417.25 | |||
| Hydrophobic surface: 485.23 | Hydrophilic surface: 203.863 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
