Type: Ionized
Formula: C10H14NO4-
SMILES: |
O=C([O-])C1[NH2+]CC(C(C)=C)C1CC(=O)[O-] |
InChI: |
InChI=1/C10H15NO4/c1-5(2)7-4-11-9(10(14)15)6(7)3-8(12)13/h6-7,9,11H,1,3-4H2,2H3,(H,12,13)(H,14,15)/p-1/t6-,7-,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 212.225 g/mol | logS: -0.84932 | SlogP: -3.3696 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.292699 | Sterimol/B1: 2.18941 | Sterimol/B2: 2.89649 | Sterimol/B3: 4.77109 |
Sterimol/B4: 5.99063 | Sterimol/L: 10.5721 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 385.694 | Positive charged surface: 225.769 | Negative charged surface: 159.925 | Volume: 198.625 |
Hydrophobic surface: 171.506 | Hydrophilic surface: 214.188 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 0 | Acid groups: 4 | Basic groups: 1 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|