 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1cccc1C([NH+]1CCOCC1)C(NC(=O)C(=O)NCc1ccc(cc1)C)C |
| InChI: | InChI=1/C21H27N3O3S/c1-15-5-7-17(8-6-15)14-22-20(25)21(26)23-16(2)19(18-4-3-13-28-18)24-9-11-27-12-10-24/h3-8,13,16,19H,9-12,14H2,1-2H3,(H,22,25)(H,23,26)/p+1/t16-,19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=76.0096 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 402.539 g/mol | logS: -4.24426 | SlogP: 1.19572 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.135278 | Sterimol/B1: 3.43825 | Sterimol/B2: 5.17758 | Sterimol/B3: 5.29473 | |||
| Sterimol/B4: 5.69222 | Sterimol/L: 18.0006 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 677.52 | Positive charged surface: 466.215 | Negative charged surface: 211.306 | Volume: 396.75 | |||
| Hydrophobic surface: 570.773 | Hydrophilic surface: 106.747 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
