 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(OC2C(N)C(O)C(OC)C(N(C(=O)CN)C)C2O)C(N)CCC1C([NH3+])C |
| InChI: | InChI=1/C17H35N5O6/c1-7(19)9-5-4-8(20)17(27-9)28-15-11(21)13(24)16(26-3)12(14(15)25)22(2)10(23)6-18/h7-9,11-17,24-25H,4-6,18-21H2,1-3H3/p+1/t7-,8-,9-,11+,12+,13-,14-,15+,16+,17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=118.926 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 406.504 g/mol | logS: 0.66983 | SlogP: -4.3022 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.310384 | Sterimol/B1: 2.28001 | Sterimol/B2: 3.37445 | Sterimol/B3: 5.96463 | |||
| Sterimol/B4: 8.33171 | Sterimol/L: 14.5363 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 595.041 | Positive charged surface: 510.019 | Negative charged surface: 85.0225 | Volume: 387.125 | |||
| Hydrophobic surface: 406.926 | Hydrophilic surface: 188.115 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 10 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
