 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1ccccc1C([NH+]1CCCC1)CNC(=O)C(NC(=O)N)Cc1ccccc1 |
| InChI: | InChI=1/C23H30N4O3/c1-30-21-12-6-5-11-18(21)20(27-13-7-8-14-27)16-25-22(28)19(26-23(24)29)15-17-9-3-2-4-10-17/h2-6,9-12,19-20H,7-8,13-16H2,1H3,(H,25,28)(H3,24,26,29)/p+1/t19-,20-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=36.0802 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 411.526 g/mol | logS: -3.95642 | SlogP: 0.90627 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.204694 | Sterimol/B1: 2.44321 | Sterimol/B2: 4.43597 | Sterimol/B3: 5.85497 | |||
| Sterimol/B4: 9.23624 | Sterimol/L: 16.8012 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 704.7 | Positive charged surface: 520.145 | Negative charged surface: 184.555 | Volume: 414.625 | |||
| Hydrophobic surface: 576.68 | Hydrophilic surface: 128.02 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
