 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | [nH]1c2c(nc1C(NCc1nc(nc(n1)N)Nc1ccc(cc1)C)C(C)C)cccc2 |
| InChI: | InChI=1/C22H26N8/c1-13(2)19(20-26-16-6-4-5-7-17(16)27-20)24-12-18-28-21(23)30-22(29-18)25-15-10-8-14(3)9-11-15/h4-11,13,19,24H,12H2,1-3H3,(H,26,27)(H3,23,25,28,29,30)/t19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=31.0403 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 402.506 g/mol | logS: -5.79129 | SlogP: 4.23092 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0188589 | Sterimol/B1: 2.73375 | Sterimol/B2: 3.77618 | Sterimol/B3: 5.11149 | |||
| Sterimol/B4: 6.6894 | Sterimol/L: 21.2347 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 722.043 | Positive charged surface: 476.866 | Negative charged surface: 245.177 | Volume: 395.5 | |||
| Hydrophobic surface: 512.126 | Hydrophilic surface: 209.917 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
