 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | [nH+]1c2c([nH]c1C([NH2+]Cc1nc(nc(n1)N)Nc1ccc(cc1)C)C(C)C)ccc c2 |
| InChI: | InChI=1/C22H26N8/c1-13(2)19(20-26-16-6-4-5-7-17(16)27-20)24-12-18-28-21(23)30-22(29-18)25-15-10-8-14(3)9-11-15/h4-11,13,19,24H,12H2,1-3H3,(H,26,27)(H3,23,25,28,29,30)/p+2/t19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=26.5918 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 404.522 g/mol | logS: -5.74251 | SlogP: 2.62382 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0678846 | Sterimol/B1: 3.81425 | Sterimol/B2: 4.32883 | Sterimol/B3: 6.53033 | |||
| Sterimol/B4: 6.54361 | Sterimol/L: 19.309 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 740.631 | Positive charged surface: 509.336 | Negative charged surface: 231.295 | Volume: 406.625 | |||
| Hydrophobic surface: 509.646 | Hydrophilic surface: 230.985 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 3 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
