 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1NC(=NC2=C1C[NH+](CC2)CC(O)CCC)Cc1cc(ccc1)C |
| InChI: | InChI=1/C20H27N3O2/c1-3-5-16(24)12-23-9-8-18-17(13-23)20(25)22-19(21-18)11-15-7-4-6-14(2)10-15/h4,6-7,10,16,24H,3,5,8-9,11-13H2,1-2H3,(H,21,22,25)/p+1/t16-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=24.0886 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 342.463 g/mol | logS: -4.0242 | SlogP: 0.76949 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0615205 | Sterimol/B1: 3.46567 | Sterimol/B2: 4.12321 | Sterimol/B3: 5.08366 | |||
| Sterimol/B4: 5.64171 | Sterimol/L: 19.1372 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 655.431 | Positive charged surface: 476.053 | Negative charged surface: 179.377 | Volume: 355.875 | |||
| Hydrophobic surface: 517.353 | Hydrophilic surface: 138.078 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
