Type: Neutral
Formula: C19H26N2O3
SMILES: |
O(C(=O)C(NC(=O)NCCC=1CCCCC=1)Cc1ccccc1)C |
InChI: |
InChI=1/C19H26N2O3/c1-24-18(22)17(14-16-10-6-3-7-11-16)21-19(23)20-13-12-15-8-4-2-5-9-15/h3,6-8,10-11,17H,2,4-5,9,12-14H2,1H3,(H2,20,21,23)/t17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 330.428 g/mol | logS: -3.80922 | SlogP: 2.96037 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0602289 | Sterimol/B1: 1.9723 | Sterimol/B2: 3.0802 | Sterimol/B3: 4.02907 |
Sterimol/B4: 10.9918 | Sterimol/L: 16.0213 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 646.435 | Positive charged surface: 463.294 | Negative charged surface: 183.14 | Volume: 337.875 |
Hydrophobic surface: 553.083 | Hydrophilic surface: 93.352 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |