 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NCCC(C)C)C(N(C(=O)Cn1nnc2c1cccc2)C1CC1)c1cccnc1 |
| InChI: | InChI=1/C23H28N6O2/c1-16(2)11-13-25-23(31)22(17-6-5-12-24-14-17)29(18-9-10-18)21(30)15-28-20-8-4-3-7-19(20)26-27-28/h3-8,12,14,16,18,22H,9-11,13,15H2,1-2H3,(H,25,31)/t22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=118.718 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 420.517 g/mol | logS: -3.91138 | SlogP: 3.0828 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.087773 | Sterimol/B1: 3.19893 | Sterimol/B2: 3.47074 | Sterimol/B3: 4.44066 | |||
| Sterimol/B4: 10.9199 | Sterimol/L: 15.5094 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 711.973 | Positive charged surface: 459.083 | Negative charged surface: 252.89 | Volume: 413 | |||
| Hydrophobic surface: 535.527 | Hydrophilic surface: 176.446 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.