Type: Neutral
Formula: C18H23F3N2O3S
SMILES: |
s1cccc1C(N(CC1OCCC1)C(=O)C(F)(F)F)C(=O)NC1CCCC1 |
InChI: |
InChI=1/C18H23F3N2O3S/c19-18(20,21)17(25)23(11-13-7-3-9-26-13)15(14-8-4-10-27-14)16(24)22-12-5-1-2-6-12/h4,8,10,12-13,15H,1-3,5-7,9,11H2,(H,22,24)/t13-,15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 404.453 g/mol | logS: -4.13819 | SlogP: 3.9333 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.17868 | Sterimol/B1: 2.49564 | Sterimol/B2: 4.27015 | Sterimol/B3: 5.4928 |
Sterimol/B4: 8.66028 | Sterimol/L: 15.5022 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 611.583 | Positive charged surface: 382.599 | Negative charged surface: 228.984 | Volume: 350.125 |
Hydrophobic surface: 492.61 | Hydrophilic surface: 118.973 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |